C8H14N4O3 — CID 103263516
3-hydroxy-4-[2-(triazol-1-yl)ethylamino]butanoic acid (PubChem CID 103263516) has the molecular formula C8H14N4O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-hydroxy-4-[2-(triazol-1-yl)ethylamino]butanoic acid.
| Compound Name | 3-hydroxy-4-[2-(triazol-1-yl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 103263516 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-hydroxy-4-[2-(triazol-1-yl)ethylamino]butanoic acid |
| SMILES | O=C(O)CC(O)CNCCn1ccnn1 |
| InChI | InChI=1S/C8H14N4O3/c13-7(5-8(14)15)6-9-1-3-12-4-2-10-11-12/h2,4,7,9,13H,1,3,5-6H2,(H,14,15) |
| InChIKey | QSHVVGXUZJOZRK-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|