C7H14N6O — CID 103263505
2-amino-3-[2-(triazol-1-yl)ethylamino]propanamide (PubChem CID 103263505) has the molecular formula C7H14N6O and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-amino-3-[2-(triazol-1-yl)ethylamino]propanamide.
| Compound Name | 2-amino-3-[2-(triazol-1-yl)ethylamino]propanamide |
|---|---|
| PubChem CID | 103263505 |
| Molecular Formula | C7H14N6O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-amino-3-[2-(triazol-1-yl)ethylamino]propanamide |
| SMILES | NC(=O)C(N)CNCCn1ccnn1 |
| InChI | InChI=1S/C7H14N6O/c8-6(7(9)14)5-10-1-3-13-4-2-11-12-13/h2,4,6,10H,1,3,5,8H2,(H2,9,14) |
| InChIKey | WFEXZKRVKBZKTC-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|