C15H24FNO3 — CID 107851621
6-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]hexan-1-ol (PubChem CID 107851621) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 6-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]hexan-1-ol.
| Compound Name | 6-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 107851621 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 6-[[3-(2-fluorophenoxy)-2-hydroxypropyl]amino]hexan-1-ol |
| SMILES | OCCCCCCNCC(O)COc1ccccc1F |
| InChI | InChI=1S/C15H24FNO3/c16-14-7-3-4-8-15(14)20-12-13(19)11-17-9-5-1-2-6-10-18/h3-4,7-8,13,17-19H,1-2,5-6,9-12H2 |
| InChIKey | GXSDZSGVDWGSIX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|