C16H20N2O5 — CID 26011422
3-[(2S)-3-(4-acetylphenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 26011422) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[(2S)-3-(4-acetylphenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-3-(4-acetylphenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26011422 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-[(2S)-3-(4-acetylphenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC(=O)c1ccc(OC[C@@H](O)CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C16H20N2O5/c1-10(19)11-4-6-13(7-5-11)23-9-12(20)8-18-14(21)16(2,3)17-15(18)22/h4-7,12,20H,8-9H2,1-3H3,(H,17,22)/t12-/m0/s1 |
| InChIKey | RKRBNXBXUMAWAW-LBPRGKRZSA-N |
| XLogP | 0.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|