C17H27N3O2 — CID 142089489
3-(2-amino-4-phenylbutyl)-5,5-dimethylimidazolidine-2,4-dione;ethane (PubChem CID 142089489) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-(2-amino-4-phenylbutyl)-5,5-dimethylimidazolidine-2,4-dione;ethane.
| Compound Name | 3-(2-amino-4-phenylbutyl)-5,5-dimethylimidazolidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 142089489 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3-(2-amino-4-phenylbutyl)-5,5-dimethylimidazolidine-2,4-dione;ethane |
| SMILES | CC.CC1(C)NC(=O)N(CC(N)CCc2ccccc2)C1=O |
| InChI | InChI=1S/C15H21N3O2.C2H6/c1-15(2)13(19)18(14(20)17-15)10-12(16)9-8-11-6-4-3-5-7-11;1-2/h3-7,12H,8-10,16H2,1-2H3,(H,17,20);1-2H3 |
| InChIKey | LSDDQCPQWCRIIE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|