C19H23N3O3 — CID 34185684
3-[2-[benzyl(furan-2-ylmethyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 34185684) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[2-[benzyl(furan-2-ylmethyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[benzyl(furan-2-ylmethyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 34185684 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3-[2-[benzyl(furan-2-ylmethyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCN(Cc2ccccc2)Cc2ccco2)C1=O |
| InChI | InChI=1S/C19H23N3O3/c1-19(2)17(23)22(18(24)20-19)11-10-21(14-16-9-6-12-25-16)13-15-7-4-3-5-8-15/h3-9,12H,10-11,13-14H2,1-2H3,(H,20,24) |
| InChIKey | PNRVGYNESQSGSG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|