C22H27NO3 — CID 46014026
3-[5-[[benzyl(furan-2-ylmethyl)amino]methyl]furan-2-yl]pentan-3-ol (PubChem CID 46014026) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 3-[5-[[benzyl(furan-2-ylmethyl)amino]methyl]furan-2-yl]pentan-3-ol.
| Compound Name | 3-[5-[[benzyl(furan-2-ylmethyl)amino]methyl]furan-2-yl]pentan-3-ol |
|---|---|
| PubChem CID | 46014026 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 3-[5-[[benzyl(furan-2-ylmethyl)amino]methyl]furan-2-yl]pentan-3-ol |
| SMILES | CCC(O)(CC)c1ccc(CN(Cc2ccccc2)Cc2ccco2)o1 |
| InChI | InChI=1S/C22H27NO3/c1-3-22(24,4-2)21-13-12-20(26-21)17-23(16-19-11-8-14-25-19)15-18-9-6-5-7-10-18/h5-14,24H,3-4,15-17H2,1-2H3 |
| InChIKey | MARWOEDLKDBOGM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |