C20H27NO4 — CID 24714559
4-[5-[[furan-2-ylmethyl(2-methoxyethyl)amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol (PubChem CID 24714559) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-[5-[[furan-2-ylmethyl(2-methoxyethyl)amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[5-[[furan-2-ylmethyl(2-methoxyethyl)amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 24714559 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[5-[[furan-2-ylmethyl(2-methoxyethyl)amino]methyl]furan-2-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)c1ccc(CN(CCOC)Cc2ccco2)o1 |
| InChI | InChI=1S/C20H27NO4/c1-4-10-20(22,11-5-2)19-9-8-18(25-19)16-21(12-14-23-3)15-17-7-6-13-24-17/h4-9,13,22H,1-2,10-12,14-16H2,3H3 |
| InChIKey | FCIYSESBOZCBOF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|