C25H34FNO3 — CID 46017559
5-[5-[[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol (PubChem CID 46017559) has the molecular formula C25H34FNO3 and a molecular weight of 415.55 g/mol. Its IUPAC name is 5-[5-[[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol.
| Compound Name | 5-[5-[[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 46017559 |
| Molecular Formula | C25H34FNO3 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | 5-[5-[[(2-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]nona-1,8-dien-5-ol |
| SMILES | C=CCCC(O)(CCC=C)c1ccc(CN(CCCOC)Cc2ccccc2F)o1 |
| InChI | InChI=1S/C25H34FNO3/c1-4-6-15-25(28,16-7-5-2)24-14-13-22(30-24)20-27(17-10-18-29-3)19-21-11-8-9-12-23(21)26/h4-5,8-9,11-14,28H,1-2,6-7,10,15-20H2,3H3 |
| InChIKey | XIMVRRQUVFOYKX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|