C22H35NO4 — CID 42839321
4-[5-[[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]heptan-4-ol (PubChem CID 42839321) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-[5-[[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]heptan-4-ol.
| Compound Name | 4-[5-[[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]heptan-4-ol |
|---|---|
| PubChem CID | 42839321 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 4-[5-[[3-methoxypropyl-[(5-methylfuran-2-yl)methyl]amino]methyl]furan-2-yl]heptan-4-ol |
| SMILES | CCCC(O)(CCC)c1ccc(CN(CCCOC)Cc2ccc(C)o2)o1 |
| InChI | InChI=1S/C22H35NO4/c1-5-12-22(24,13-6-2)21-11-10-20(27-21)17-23(14-7-15-25-4)16-19-9-8-18(3)26-19/h8-11,24H,5-7,12-17H2,1-4H3 |
| InChIKey | YXMLBFHUDFIBJB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|