C24H27NO3S3 — CID 46015495
[5-[[3-methoxypropyl-[(5-methylthiophen-2-yl)methyl]amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol (PubChem CID 46015495) has the molecular formula C24H27NO3S3 and a molecular weight of 473.69 g/mol. Its IUPAC name is [5-[[3-methoxypropyl-[(5-methylthiophen-2-yl)methyl]amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol.
| Compound Name | [5-[[3-methoxypropyl-[(5-methylthiophen-2-yl)methyl]amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
|---|---|
| PubChem CID | 46015495 |
| Molecular Formula | C24H27NO3S3 |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [5-[[3-methoxypropyl-[(5-methylthiophen-2-yl)methyl]amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
| SMILES | COCCCN(Cc1ccc(C(O)(c2cccs2)c2cccs2)o1)Cc1ccc(C)s1 |
| InChI | InChI=1S/C24H27NO3S3/c1-18-8-10-20(31-18)17-25(12-5-13-27-2)16-19-9-11-21(28-19)24(26,22-6-3-14-29-22)23-7-4-15-30-23/h3-4,6-11,14-15,26H,5,12-13,16-17H2,1-2H3 |
| InChIKey | FARUNCUDMFUXDO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|