C25H26FNO3S2 — CID 46017728
[5-[[(3-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol (PubChem CID 46017728) has the molecular formula C25H26FNO3S2 and a molecular weight of 471.62 g/mol. Its IUPAC name is [5-[[(3-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol.
| Compound Name | [5-[[(3-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
|---|---|
| PubChem CID | 46017728 |
| Molecular Formula | C25H26FNO3S2 |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [5-[[(3-fluorophenyl)methyl-(3-methoxypropyl)amino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
| SMILES | COCCCN(Cc1cccc(F)c1)Cc1ccc(C(O)(c2cccs2)c2cccs2)o1 |
| InChI | InChI=1S/C25H26FNO3S2/c1-29-13-5-12-27(17-19-6-2-7-20(26)16-19)18-21-10-11-22(30-21)25(28,23-8-3-14-31-23)24-9-4-15-32-24/h2-4,6-11,14-16,28H,5,12-13,17-18H2,1H3 |
| InChIKey | JXPMRSGVJDALGD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|