C28H28FNO2 — CID 46017730
[5-[[(3-fluorophenyl)methyl-propylamino]methyl]furan-2-yl]-diphenylmethanol (PubChem CID 46017730) has the molecular formula C28H28FNO2 and a molecular weight of 429.54 g/mol. Its IUPAC name is [5-[[(3-fluorophenyl)methyl-propylamino]methyl]furan-2-yl]-diphenylmethanol.
| Compound Name | [5-[[(3-fluorophenyl)methyl-propylamino]methyl]furan-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 46017730 |
| Molecular Formula | C28H28FNO2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [5-[[(3-fluorophenyl)methyl-propylamino]methyl]furan-2-yl]-diphenylmethanol |
| SMILES | CCCN(Cc1cccc(F)c1)Cc1ccc(C(O)(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C28H28FNO2/c1-2-18-30(20-22-10-9-15-25(29)19-22)21-26-16-17-27(32-26)28(31,23-11-5-3-6-12-23)24-13-7-4-8-14-24/h3-17,19,31H,2,18,20-21H2,1H3 |
| InChIKey | XLQUQWLXDLTTNF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |