C24H24FNO2S2 — CID 46017550
[5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]furan-2-yl]-dithiophen-2-ylmethanol (PubChem CID 46017550) has the molecular formula C24H24FNO2S2 and a molecular weight of 441.59 g/mol. Its IUPAC name is [5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]furan-2-yl]-dithiophen-2-ylmethanol.
| Compound Name | [5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
|---|---|
| PubChem CID | 46017550 |
| Molecular Formula | C24H24FNO2S2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]furan-2-yl]-dithiophen-2-ylmethanol |
| SMILES | CC(C)N(Cc1ccc(C(O)(c2cccs2)c2cccs2)o1)Cc1ccccc1F |
| InChI | InChI=1S/C24H24FNO2S2/c1-17(2)26(15-18-7-3-4-8-20(18)25)16-19-11-12-21(28-19)24(27,22-9-5-13-29-22)23-10-6-14-30-23/h3-14,17,27H,15-16H2,1-2H3 |
| InChIKey | ADPZGKUJXPWBPB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |