C24H27FN2O2 — CID 42750686
5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]-N-(1-phenylethyl)furan-2-carboxamide (PubChem CID 42750686) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]-N-(1-phenylethyl)furan-2-carboxamide.
| Compound Name | 5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42750686 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 5-[[(2-fluorophenyl)methyl-propan-2-ylamino]methyl]-N-(1-phenylethyl)furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(CN(Cc2ccccc2F)C(C)C)o1)c1ccccc1 |
| InChI | InChI=1S/C24H27FN2O2/c1-17(2)27(15-20-11-7-8-12-22(20)25)16-21-13-14-23(29-21)24(28)26-18(3)19-9-5-4-6-10-19/h4-14,17-18H,15-16H2,1-3H3,(H,26,28) |
| InChIKey | JXDHWMBCJVCLFM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |