C11H16F3N3O2 — CID 55215009
5-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]furan-2-carbohydrazide (PubChem CID 55215009) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]furan-2-carbohydrazide.
| Compound Name | 5-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 55215009 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]furan-2-carbohydrazide |
| SMILES | CC(C)N(Cc1ccc(C(=O)NN)o1)CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O2/c1-7(2)17(6-11(12,13)14)5-8-3-4-9(19-8)10(18)16-15/h3-4,7H,5-6,15H2,1-2H3,(H,16,18) |
| InChIKey | MTAIBLVZEFWMNE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|