C12H21N3O4 — CID 63578022
5-[[bis(2-methoxyethyl)amino]methyl]furan-2-carbohydrazide (PubChem CID 63578022) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-[[bis(2-methoxyethyl)amino]methyl]furan-2-carbohydrazide.
| Compound Name | 5-[[bis(2-methoxyethyl)amino]methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63578022 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 5-[[bis(2-methoxyethyl)amino]methyl]furan-2-carbohydrazide |
| SMILES | COCCN(CCOC)Cc1ccc(C(=O)NN)o1 |
| InChI | InChI=1S/C12H21N3O4/c1-17-7-5-15(6-8-18-2)9-10-3-4-11(19-10)12(16)14-13/h3-4H,5-9,13H2,1-2H3,(H,14,16) |
| InChIKey | JOKXAUNKQYGWKB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|