C13H21NO5 — CID 55004839
5-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]furan-2-carboxylic acid (PubChem CID 55004839) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 5-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 55004839 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 5-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]furan-2-carboxylic acid |
| SMILES | COCCN(Cc1ccc(C(=O)O)o1)C(C)COC |
| InChI | InChI=1S/C13H21NO5/c1-10(9-18-3)14(6-7-17-2)8-11-4-5-12(19-11)13(15)16/h4-5,10H,6-9H2,1-3H3,(H,15,16) |
| InChIKey | YUOMIXTZDFEPCK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |