C15H22FNO4 — CID 63292652
5-fluoro-2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]benzoic acid (PubChem CID 63292652) has the molecular formula C15H22FNO4 and a molecular weight of 299.34 g/mol. Its IUPAC name is 5-fluoro-2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]benzoic acid.
| Compound Name | 5-fluoro-2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 63292652 |
| Molecular Formula | C15H22FNO4 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-fluoro-2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]benzoic acid |
| SMILES | COCCN(Cc1ccc(F)cc1C(=O)O)C(C)COC |
| InChI | InChI=1S/C15H22FNO4/c1-11(10-21-3)17(6-7-20-2)9-12-4-5-13(16)8-14(12)15(18)19/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,18,19) |
| InChIKey | CEOATZDIUKGJCC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |