C14H20FNO3 — CID 55000117
2-[butan-2-yl(2-methoxyethyl)amino]-5-fluorobenzoic acid (PubChem CID 55000117) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[butan-2-yl(2-methoxyethyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[butan-2-yl(2-methoxyethyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 55000117 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[butan-2-yl(2-methoxyethyl)amino]-5-fluorobenzoic acid |
| SMILES | CCC(C)N(CCOC)c1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C14H20FNO3/c1-4-10(2)16(7-8-19-3)13-6-5-11(15)9-12(13)14(17)18/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | DCWFKFLKTQMMSH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |