C15H22FNO3 — CID 63075063
4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzoic acid (PubChem CID 63075063) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzoic acid.
| Compound Name | 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 63075063 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[[butan-2-yl(2-methoxyethyl)amino]methyl]-3-fluorobenzoic acid |
| SMILES | CCC(C)N(CCOC)Cc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C15H22FNO3/c1-4-11(2)17(7-8-20-3)10-13-6-5-12(15(18)19)9-14(13)16/h5-6,9,11H,4,7-8,10H2,1-3H3,(H,18,19) |
| InChIKey | KCAIMPWQRLDFFF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |