C12H16F3N3O2 — CID 62182979
2-nitro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 62182979) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is 2-nitro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2-nitro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 62182979 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-nitro-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | CC(C)N(Cc1ccc(N)c([N+](=O)[O-])c1)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O2/c1-8(2)17(7-12(13,14)15)6-9-3-4-10(16)11(5-9)18(19)20/h3-5,8H,6-7,16H2,1-2H3 |
| InChIKey | CVKZYTUMUCVTGO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|