C25H29N3O3 — CID 47076551
N-[1-(3-benzamidophenyl)ethyl]-5-(diethylaminomethyl)furan-2-carboxamide (PubChem CID 47076551) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[1-(3-benzamidophenyl)ethyl]-5-(diethylaminomethyl)furan-2-carboxamide.
| Compound Name | N-[1-(3-benzamidophenyl)ethyl]-5-(diethylaminomethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 47076551 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[1-(3-benzamidophenyl)ethyl]-5-(diethylaminomethyl)furan-2-carboxamide |
| SMILES | CCN(CC)Cc1ccc(C(=O)NC(C)c2cccc(NC(=O)c3ccccc3)c2)o1 |
| InChI | InChI=1S/C25H29N3O3/c1-4-28(5-2)17-22-14-15-23(31-22)25(30)26-18(3)20-12-9-13-21(16-20)27-24(29)19-10-7-6-8-11-19/h6-16,18H,4-5,17H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | AGTHXGKYOPQBMG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |