C24H27N3O5S — CID 55693793
N-[1-(3-benzamidophenyl)ethyl]-5-(tert-butylsulfamoyl)furan-2-carboxamide (PubChem CID 55693793) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[1-(3-benzamidophenyl)ethyl]-5-(tert-butylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-[1-(3-benzamidophenyl)ethyl]-5-(tert-butylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55693793 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[1-(3-benzamidophenyl)ethyl]-5-(tert-butylsulfamoyl)furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(S(=O)(=O)NC(C)(C)C)o1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-16(18-11-8-12-19(15-18)26-22(28)17-9-6-5-7-10-17)25-23(29)20-13-14-21(32-20)33(30,31)27-24(2,3)4/h5-16,27H,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | VMZKXQAKJUAVRG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |