C18H23N3O5S — CID 48731730
N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(tert-butylsulfamoyl)furan-2-carboxamide (PubChem CID 48731730) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(tert-butylsulfamoyl)furan-2-carboxamide.
| Compound Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(tert-butylsulfamoyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 48731730 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)-5-(tert-butylsulfamoyl)furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NC(Cc2ccccc2)C(N)=O)o1 |
| InChI | InChI=1S/C18H23N3O5S/c1-18(2,3)21-27(24,25)15-10-9-14(26-15)17(23)20-13(16(19)22)11-12-7-5-4-6-8-12/h4-10,13,21H,11H2,1-3H3,(H2,19,22)(H,20,23) |
| InChIKey | CODMOUKIQLXZDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |