C19H24F2N2O5S — CID 55656061
5-(tert-butylsulfamoyl)-N-[1-[2-(difluoromethoxy)phenyl]propyl]furan-2-carboxamide (PubChem CID 55656061) has the molecular formula C19H24F2N2O5S and a molecular weight of 430.47 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[1-[2-(difluoromethoxy)phenyl]propyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[1-[2-(difluoromethoxy)phenyl]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55656061 |
| Molecular Formula | C19H24F2N2O5S |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[1-[2-(difluoromethoxy)phenyl]propyl]furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(S(=O)(=O)NC(C)(C)C)o1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C19H24F2N2O5S/c1-5-13(12-8-6-7-9-14(12)28-18(20)21)22-17(24)15-10-11-16(27-15)29(25,26)23-19(2,3)4/h6-11,13,18,23H,5H2,1-4H3,(H,22,24) |
| InChIKey | ZHJKFKMRPHXYJJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |