C17H19F2NO4 — CID 78868230
N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-(methoxymethyl)furan-2-carboxamide (PubChem CID 78868230) has the molecular formula C17H19F2NO4 and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-(methoxymethyl)furan-2-carboxamide.
| Compound Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-(methoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78868230 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)phenyl]propyl]-5-(methoxymethyl)furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(COC)o1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H19F2NO4/c1-3-13(12-6-4-5-7-14(12)24-17(18)19)20-16(21)15-9-8-11(23-15)10-22-2/h4-9,13,17H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | IRHLRTIZLADOMD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |