C15H18N2O5S — CID 86989733
pyridin-2-ylmethyl 5-(tert-butylsulfamoyl)furan-2-carboxylate (PubChem CID 86989733) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is pyridin-2-ylmethyl 5-(tert-butylsulfamoyl)furan-2-carboxylate.
| Compound Name | pyridin-2-ylmethyl 5-(tert-butylsulfamoyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 86989733 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | pyridin-2-ylmethyl 5-(tert-butylsulfamoyl)furan-2-carboxylate |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)OCc2ccccn2)o1 |
| InChI | InChI=1S/C15H18N2O5S/c1-15(2,3)17-23(19,20)13-8-7-12(22-13)14(18)21-10-11-6-4-5-9-16-11/h4-9,17H,10H2,1-3H3 |
| InChIKey | GREPAKYDGGQTKR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |