About pyridin-2-ylmethyl 2-hydroxybenzoate
pyridin-2-ylmethyl 2-hydroxybenzoate (PubChem CID 43053918) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-hydroxybenzoate |
| PubChem CID | 43053918 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | pyridin-2-ylmethyl 2-hydroxybenzoate |
| SMILES | O=C(OCc1ccccn1)c1ccccc1O |
| InChI | InChI=1S/C13H11NO3/c15-12-7-2-1-6-11(12)13(16)17-9-10-5-3-4-8-14-10/h1-8,15H,9H2 |
| InChIKey | XGSSAESCCGIFSY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-ylmethyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-hydroxybenzoate?
The IUPAC name of pyridin-2-ylmethyl 2-hydroxybenzoate (CID 43053918) is pyridin-2-ylmethyl 2-hydroxybenzoate.
What is the SMILES notation for pyridin-2-ylmethyl 2-hydroxybenzoate?
The canonical SMILES for pyridin-2-ylmethyl 2-hydroxybenzoate is O=C(OCc1ccccn1)c1ccccc1O.
What is the InChIKey of pyridin-2-ylmethyl 2-hydroxybenzoate?
The InChIKey is XGSSAESCCGIFSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c15-12-7-2-1-6-11(12)13(16)17-9-10-5-3-4-8-14-10/h1-8,15H,9H2.
What are the key properties of pyridin-2-ylmethyl 2-hydroxybenzoate?
pyridin-2-ylmethyl 2-hydroxybenzoate has a molecular weight of 229.24 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-hydroxybenzoate is sourced from PubChem (CID 43053918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).