About pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate
pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate (PubChem CID 46562340) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate |
| PubChem CID | 46562340 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate |
| SMILES | Cc1nc(-c2ccccc2)ccc1C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C19H16N2O2/c1-14-17(19(22)23-13-16-9-5-6-12-20-16)10-11-18(21-14)15-7-3-2-4-8-15/h2-12H,13H2,1H3 |
| InChIKey | FYJAKJRBAMPTNJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate?
The IUPAC name of pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate (CID 46562340) is pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate.
What is the SMILES notation for pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate?
The canonical SMILES for pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate is Cc1nc(-c2ccccc2)ccc1C(=O)OCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate?
The InChIKey is FYJAKJRBAMPTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2/c1-14-17(19(22)23-13-16-9-5-6-12-20-16)10-11-18(21-14)15-7-3-2-4-8-15/h2-12H,13H2,1H3.
What are the key properties of pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate?
pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate has a molecular weight of 304.35 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-methyl-6-phenylpyridine-3-carboxylate is sourced from PubChem (CID 46562340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).