About pyridin-2-ylmethyl 2-aminopropanoate
pyridin-2-ylmethyl 2-aminopropanoate (PubChem CID 83529934) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-aminopropanoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-aminopropanoate |
| PubChem CID | 83529934 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | pyridin-2-ylmethyl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C9H12N2O2/c1-7(10)9(12)13-6-8-4-2-3-5-11-8/h2-5,7H,6,10H2,1H3 |
| InChIKey | OOWCPYQUDRRVEX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-2-ylmethyl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-aminopropanoate?
The IUPAC name of pyridin-2-ylmethyl 2-aminopropanoate (CID 83529934) is pyridin-2-ylmethyl 2-aminopropanoate.
What is the SMILES notation for pyridin-2-ylmethyl 2-aminopropanoate?
The canonical SMILES for pyridin-2-ylmethyl 2-aminopropanoate is CC(N)C(=O)OCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl 2-aminopropanoate?
The InChIKey is OOWCPYQUDRRVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-7(10)9(12)13-6-8-4-2-3-5-11-8/h2-5,7H,6,10H2,1H3.
What are the key properties of pyridin-2-ylmethyl 2-aminopropanoate?
pyridin-2-ylmethyl 2-aminopropanoate has a molecular weight of 180.21 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-aminopropanoate is sourced from PubChem (CID 83529934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).