C22H28N2O4 — CID 102384710
bis(pyridin-2-ylmethyl) (2S,3S)-2,3-dipropylbutanedioate (PubChem CID 102384710) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is bis(pyridin-2-ylmethyl) (2S,3S)-2,3-dipropylbutanedioate.
| Compound Name | bis(pyridin-2-ylmethyl) (2S,3S)-2,3-dipropylbutanedioate |
|---|---|
| PubChem CID | 102384710 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | bis(pyridin-2-ylmethyl) (2S,3S)-2,3-dipropylbutanedioate |
| SMILES | CCC[C@H](C(=O)OCc1ccccn1)[C@H](CCC)C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C22H28N2O4/c1-3-9-19(21(25)27-15-17-11-5-7-13-23-17)20(10-4-2)22(26)28-16-18-12-6-8-14-24-18/h5-8,11-14,19-20H,3-4,9-10,15-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | QZNQKIBGKXDVSW-PMACEKPBSA-N |
| XLogP | 4.10 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |