C15H15ClN2O4S — CID 55941598
pyridin-2-ylmethyl (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 55941598) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is pyridin-2-ylmethyl (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | pyridin-2-ylmethyl (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55941598 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | pyridin-2-ylmethyl (2S)-2-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCc1ccccn1 |
| InChI | InChI=1S/C15H15ClN2O4S/c1-11(15(19)22-10-13-4-2-3-9-17-13)18-23(20,21)14-7-5-12(16)6-8-14/h2-9,11,18H,10H2,1H3/t11-/m0/s1 |
| InChIKey | HXJAIJIPRWOWIS-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |