C19H16ClN3O4S — CID 42936714
(1-cyanoindolizin-2-yl)methyl 2-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 42936714) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42936714 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | CC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)OCc1cn2ccccc2c1C#N |
| InChI | InChI=1S/C19H16ClN3O4S/c1-13(22-28(25,26)16-7-5-15(20)6-8-16)19(24)27-12-14-11-23-9-3-2-4-18(23)17(14)10-21/h2-9,11,13,22H,12H2,1H3 |
| InChIKey | YMNZVQVUJKLMNJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |