C23H21N3O4 — CID 16617093
(1-cyanoindolizin-2-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 16617093) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 16617093 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H](C)C(=O)OCc2cn3ccccc3c2C#N)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-16(25-22(27)11-8-17-6-9-19(29-2)10-7-17)23(28)30-15-18-14-26-12-4-3-5-21(26)20(18)13-24/h3-12,14,16H,15H2,1-2H3,(H,25,27)/b11-8+/t16-/m0/s1 |
| InChIKey | LBDAFMUCQULFGF-KXKDPZRNSA-N |
| XLogP | 3.08 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|