C24H19N3O5S — CID 16617004
(1-cyanoindolizin-2-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]benzoate (PubChem CID 16617004) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]benzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16617004 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-[(4-methoxyphenyl)sulfonylamino]benzoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C(=O)OCc2cn3ccccc3c2C#N)cc1 |
| InChI | InChI=1S/C24H19N3O5S/c1-31-18-9-11-19(12-10-18)33(29,30)26-22-7-3-2-6-20(22)24(28)32-16-17-15-27-13-5-4-8-23(27)21(17)14-25/h2-13,15,26H,16H2,1H3 |
| InChIKey | FFJOWUFWAURBHB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |