C23H25N3O5 — CID 9114906
3-(2-oxo-3H-benzimidazol-1-yl)propyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 9114906) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-(2-oxo-3H-benzimidazol-1-yl)propyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 9114906 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-(2-oxo-3H-benzimidazol-1-yl)propyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H](C)C(=O)OCCCn2c(=O)[nH]c3ccccc32)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-16(24-21(27)13-10-17-8-11-18(30-2)12-9-17)22(28)31-15-5-14-26-20-7-4-3-6-19(20)25-23(26)29/h3-4,6-13,16H,5,14-15H2,1-2H3,(H,24,27)(H,25,29)/b13-10+/t16-/m0/s1 |
| InChIKey | KEEDCLXSWILORX-ISBHARSQSA-N |
| XLogP | 2.49 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|