C19H25N5O4 — CID 7608080
(1-butyltetrazol-5-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 7608080) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | (1-butyltetrazol-5-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 7608080 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl (2S)-2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | CCCCn1nnnc1COC(=O)[C@H](C)NC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25N5O4/c1-4-5-12-24-17(21-22-23-24)13-28-19(26)14(2)20-18(25)11-8-15-6-9-16(27-3)10-7-15/h6-11,14H,4-5,12-13H2,1-3H3,(H,20,25)/b11-8+/t14-/m0/s1 |
| InChIKey | ONXBWVSZJAMHAT-ZHZWZMEUSA-N |
| XLogP | 1.74 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|