C18H21N5O3 — CID 18123694
(1-butyltetrazol-5-yl)methyl 7-methoxy-2-methylquinoline-3-carboxylate (PubChem CID 18123694) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 7-methoxy-2-methylquinoline-3-carboxylate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 7-methoxy-2-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18123694 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 7-methoxy-2-methylquinoline-3-carboxylate |
| SMILES | CCCCn1nnnc1COC(=O)c1cc2ccc(OC)cc2nc1C |
| InChI | InChI=1S/C18H21N5O3/c1-4-5-8-23-17(20-21-22-23)11-26-18(24)15-9-13-6-7-14(25-3)10-16(13)19-12(15)2/h6-7,9-10H,4-5,8,11H2,1-3H3 |
| InChIKey | OAJPZHNNTLITQF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |