C16H16ClN5O2 — CID 55999037
(1-butyltetrazol-5-yl)methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55999037) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 2-chloroquinoline-6-carboxylate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999037 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 2-chloroquinoline-6-carboxylate |
| SMILES | CCCCn1nnnc1COC(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C16H16ClN5O2/c1-2-3-8-22-15(19-20-21-22)10-24-16(23)12-4-6-13-11(9-12)5-7-14(17)18-13/h4-7,9H,2-3,8,10H2,1H3 |
| InChIKey | WEAXZZPOATVNAF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|