About (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate
(1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate (PubChem CID 35283063) has the molecular formula C18H21N5O3S
and a molecular weight of 387.47 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate.
Molecular Properties
| Compound Name | (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate |
| PubChem CID | 35283063 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate |
| SMILES | CCCCn1nnnc1COC(=O)c1ccc(OCc2csc(C)n2)cc1 |
| InChI | InChI=1S/C18H21N5O3S/c1-3-4-9-23-17(20-21-22-23)11-26-18(24)14-5-7-16(8-6-14)25-10-15-12-27-13(2)19-15/h5-8,12H,3-4,9-11H2,1-2H3 |
| InChIKey | KOADDSBOOOBEDI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate?
The IUPAC name of (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate (CID 35283063) is (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate.
What is the SMILES notation for (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate?
The canonical SMILES for (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate is CCCCn1nnnc1COC(=O)c1ccc(OCc2csc(C)n2)cc1.
What is the InChIKey of (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate?
The InChIKey is KOADDSBOOOBEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O3S/c1-3-4-9-23-17(20-21-22-23)11-26-18(24)14-5-7-16(8-6-14)25-10-15-12-27-13(2)19-15/h5-8,12H,3-4,9-11H2,1-2H3.
What are the key properties of (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate?
(1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate has a molecular weight of 387.47 g/mol, XLogP of 3.17, 9 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butyltetrazol-5-yl)methyl 4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzoate is sourced from PubChem (CID 35283063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).