C18H12Cl2N2O2 — CID 16619565
(1-cyanoindolizin-2-yl)methyl 2-(2,4-dichlorophenyl)acetate (PubChem CID 16619565) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-(2,4-dichlorophenyl)acetate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-(2,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 16619565 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-(2,4-dichlorophenyl)acetate |
| SMILES | N#Cc1c(COC(=O)Cc2ccc(Cl)cc2Cl)cn2ccccc12 |
| InChI | InChI=1S/C18H12Cl2N2O2/c19-14-5-4-12(16(20)8-14)7-18(23)24-11-13-10-22-6-2-1-3-17(22)15(13)9-21/h1-6,8,10H,7,11H2 |
| InChIKey | HJOOLCDGJIWLAJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |