C21H24N2O4S — CID 8941440
(2-cyanophenyl)methyl (2S)-2-[(4-tert-butylphenyl)sulfonylamino]propanoate (PubChem CID 8941440) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2-cyanophenyl)methyl (2S)-2-[(4-tert-butylphenyl)sulfonylamino]propanoate.
| Compound Name | (2-cyanophenyl)methyl (2S)-2-[(4-tert-butylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8941440 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2-cyanophenyl)methyl (2S)-2-[(4-tert-butylphenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCc1ccccc1C#N |
| InChI | InChI=1S/C21H24N2O4S/c1-15(20(24)27-14-17-8-6-5-7-16(17)13-22)23-28(25,26)19-11-9-18(10-12-19)21(2,3)4/h5-12,15,23H,14H2,1-4H3/t15-/m0/s1 |
| InChIKey | IKJYTTSBJHTAFV-HNNXBMFYSA-N |
| XLogP | 3.27 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |