C20H18FNO4S — CID 8936257
naphthalen-1-ylmethyl (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 8936257) has the molecular formula C20H18FNO4S and a molecular weight of 387.43 g/mol. Its IUPAC name is naphthalen-1-ylmethyl (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | naphthalen-1-ylmethyl (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8936257 |
| Molecular Formula | C20H18FNO4S |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | naphthalen-1-ylmethyl (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H18FNO4S/c1-14(22-27(24,25)18-11-9-17(21)10-12-18)20(23)26-13-16-7-4-6-15-5-2-3-8-19(15)16/h2-12,14,22H,13H2,1H3/t14-/m0/s1 |
| InChIKey | MQOFMWBMLHBGTI-AWEZNQCLSA-N |
| XLogP | 3.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |