C22H24N4O5S — CID 55783720
5-(tert-butylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 55783720) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55783720 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)Nc2cccc(C(=O)NCc3ccccn3)c2)o1 |
| InChI | InChI=1S/C22H24N4O5S/c1-22(2,3)26-32(29,30)19-11-10-18(31-19)21(28)25-16-9-6-7-15(13-16)20(27)24-14-17-8-4-5-12-23-17/h4-13,26H,14H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | STQGUAUKGKGOJK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |