C20H21FN2O4S2 — CID 55650141
5-(tert-butylsulfamoyl)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]furan-2-carboxamide (PubChem CID 55650141) has the molecular formula C20H21FN2O4S2 and a molecular weight of 436.53 g/mol. Its IUPAC name is 5-(tert-butylsulfamoyl)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]furan-2-carboxamide.
| Compound Name | 5-(tert-butylsulfamoyl)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55650141 |
| Molecular Formula | C20H21FN2O4S2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 5-(tert-butylsulfamoyl)-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]furan-2-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(C(=O)NC(c2ccc(F)cc2)c2cccs2)o1 |
| InChI | InChI=1S/C20H21FN2O4S2/c1-20(2,3)23-29(25,26)17-11-10-15(27-17)19(24)22-18(16-5-4-12-28-16)13-6-8-14(21)9-7-13/h4-12,18,23H,1-3H3,(H,22,24) |
| InChIKey | AIPSZUDQWSJIFW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |