C17H12ClFN2OS — CID 95932121
3-chloro-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide (PubChem CID 95932121) has the molecular formula C17H12ClFN2OS and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-chloro-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95932121 |
| Molecular Formula | C17H12ClFN2OS |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-chloro-N-[(R)-(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-4-carboxamide |
| SMILES | O=C(N[C@H](c1ccc(F)cc1)c1cccs1)c1ccncc1Cl |
| InChI | InChI=1S/C17H12ClFN2OS/c18-14-10-20-8-7-13(14)17(22)21-16(15-2-1-9-23-15)11-3-5-12(19)6-4-11/h1-10,16H,(H,21,22)/t16-/m1/s1 |
| InChIKey | BMYBQVVANOZGMJ-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |