C17H10Cl2F2N2OS — CID 51135593
2,6-dichloro-5-fluoro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide (PubChem CID 51135593) has the molecular formula C17H10Cl2F2N2OS and a molecular weight of 399.25 g/mol. Its IUPAC name is 2,6-dichloro-5-fluoro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-5-fluoro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51135593 |
| Molecular Formula | C17H10Cl2F2N2OS |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | 2,6-dichloro-5-fluoro-N-[(4-fluorophenyl)-thiophen-2-ylmethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(c1ccc(F)cc1)c1cccs1)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C17H10Cl2F2N2OS/c18-15-11(8-12(21)16(19)23-15)17(24)22-14(13-2-1-7-25-13)9-3-5-10(20)6-4-9/h1-8,14H,(H,22,24) |
| InChIKey | LQKGSYUWHLDYPP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|