C16H11ClFNOS2 — CID 129354884
2-chloro-4-fluoro-N-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]benzamide (PubChem CID 129354884) has the molecular formula C16H11ClFNOS2 and a molecular weight of 351.86 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]benzamide.
| Compound Name | 2-chloro-4-fluoro-N-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 129354884 |
| Molecular Formula | C16H11ClFNOS2 |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-chloro-4-fluoro-N-[(S)-thiophen-2-yl(thiophen-3-yl)methyl]benzamide |
| SMILES | O=C(N[C@@H](c1ccsc1)c1cccs1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H11ClFNOS2/c17-13-8-11(18)3-4-12(13)16(20)19-15(10-5-7-21-9-10)14-2-1-6-22-14/h1-9,15H,(H,19,20)/t15-/m0/s1 |
| InChIKey | OPJNZNMHLQWAGY-HNNXBMFYSA-N |
| XLogP | 5.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |