C14H22N2O5 — CID 43170259
2-[[5-(diethylaminomethyl)furan-2-carbonyl]amino]-3-hydroxybutanoic acid (PubChem CID 43170259) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[[5-(diethylaminomethyl)furan-2-carbonyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[5-(diethylaminomethyl)furan-2-carbonyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 43170259 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[[5-(diethylaminomethyl)furan-2-carbonyl]amino]-3-hydroxybutanoic acid |
| SMILES | CCN(CC)Cc1ccc(C(=O)NC(C(=O)O)C(C)O)o1 |
| InChI | InChI=1S/C14H22N2O5/c1-4-16(5-2)8-10-6-7-11(21-10)13(18)15-12(9(3)17)14(19)20/h6-7,9,12,17H,4-5,8H2,1-3H3,(H,15,18)(H,19,20) |
| InChIKey | YWZXLYRFZKNVSR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |